C26H37NO4SSi — CID 131724398
3-(2-tert-butylsilyloxypropan-2-yl)-7-[2-[4-(diethylamino)phenyl]ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbaldehyde (PubChem CID 131724398) has the molecular formula C26H37NO4SSi and a molecular weight of 487.74 g/mol. Its IUPAC name is 3-(2-tert-butylsilyloxypropan-2-yl)-7-[2-[4-(diethylamino)phenyl]ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbaldehyde.
| Compound Name | 3-(2-tert-butylsilyloxypropan-2-yl)-7-[2-[4-(diethylamino)phenyl]ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbaldehyde |
|---|---|
| PubChem CID | 131724398 |
| Molecular Formula | C26H37NO4SSi |
| Molecular Weight | 487.74 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 3-(2-tert-butylsilyloxypropan-2-yl)-7-[2-[4-(diethylamino)phenyl]ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbaldehyde |
| SMILES | CCN(CC)c1ccc(C=Cc2sc(C=O)c3c2OCC(C(C)(C)O[SiH2]C(C)(C)C)O3)cc1 |
| InChI | InChI=1S/C26H37NO4SSi/c1-8-27(9-2)19-13-10-18(11-14-19)12-15-20-23-24(21(16-28)32-20)30-22(17-29-23)26(6,7)31-33-25(3,4)5/h10-16,22H,8-9,17,33H2,1-7H3 |
| InChIKey | CLTUSLJAZGEDKW-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.74 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|