C12H19ClO2SSi — CID 131745495
4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-chlorothiophene-2-carbaldehyde (PubChem CID 131745495) has the molecular formula C12H19ClO2SSi and a molecular weight of 290.89 g/mol. Its IUPAC name is 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-chlorothiophene-2-carbaldehyde.
| Compound Name | 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-chlorothiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 131745495 |
| Molecular Formula | C12H19ClO2SSi |
| Molecular Weight | 290.89 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-chlorothiophene-2-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cc(C=O)sc1Cl |
| InChI | InChI=1S/C12H19ClO2SSi/c1-12(2,3)17(4,5)15-8-9-6-10(7-14)16-11(9)13/h6-7H,8H2,1-5H3 |
| InChIKey | WSINWJOYLBMJPY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.89 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|