C12H21NO2SSi — CID 131745469
4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-1,3-thiazole-2-carbaldehyde (PubChem CID 131745469) has the molecular formula C12H21NO2SSi and a molecular weight of 271.46 g/mol. Its IUPAC name is 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-1,3-thiazole-2-carbaldehyde.
| Compound Name | 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-1,3-thiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 131745469 |
| Molecular Formula | C12H21NO2SSi |
| Molecular Weight | 271.46 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-1,3-thiazole-2-carbaldehyde |
| SMILES | Cc1sc(C=O)nc1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H21NO2SSi/c1-9-10(13-11(7-14)16-9)8-15-17(5,6)12(2,3)4/h7H,8H2,1-6H3 |
| InChIKey | SEEFVVGBDUFCEU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|