C14H22ClNO2Si — CID 87286998
N-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chlorophenyl]methylidene]hydroxylamine (PubChem CID 87286998) has the molecular formula C14H22ClNO2Si and a molecular weight of 299.87 g/mol. Its IUPAC name is N-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chlorophenyl]methylidene]hydroxylamine.
| Compound Name | N-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chlorophenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 87286998 |
| Molecular Formula | C14H22ClNO2Si |
| Molecular Weight | 299.87 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | N-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chlorophenyl]methylidene]hydroxylamine |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cc(C=NO)ccc1Cl |
| InChI | InChI=1S/C14H22ClNO2Si/c1-14(2,3)19(4,5)18-10-12-8-11(9-16-17)6-7-13(12)15/h6-9,17H,10H2,1-5H3 |
| InChIKey | ABOADBJOYZAAIQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.87 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|