C25H39NOSi2 — CID 140798524
N-[[tert-butyl(dimethyl)silyl]oxy-methyl-[4-(1-phenylethenyl)phenyl]silyl]-N-ethylethanamine (PubChem CID 140798524) has the molecular formula C25H39NOSi2 and a molecular weight of 425.77 g/mol. Its IUPAC name is N-[[tert-butyl(dimethyl)silyl]oxy-methyl-[4-(1-phenylethenyl)phenyl]silyl]-N-ethylethanamine.
| Compound Name | N-[[tert-butyl(dimethyl)silyl]oxy-methyl-[4-(1-phenylethenyl)phenyl]silyl]-N-ethylethanamine |
|---|---|
| PubChem CID | 140798524 |
| Molecular Formula | C25H39NOSi2 |
| Molecular Weight | 425.77 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | N-[[tert-butyl(dimethyl)silyl]oxy-methyl-[4-(1-phenylethenyl)phenyl]silyl]-N-ethylethanamine |
| SMILES | C=C(c1ccccc1)c1ccc([Si](C)(O[Si](C)(C)C(C)(C)C)N(CC)CC)cc1 |
| InChI | InChI=1S/C25H39NOSi2/c1-10-26(11-2)29(9,27-28(7,8)25(4,5)6)24-19-17-23(18-20-24)21(3)22-15-13-12-14-16-22/h12-20H,3,10-11H2,1-2,4-9H3 |
| InChIKey | NNGYNKWPBIZRKS-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.77 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|