C25H45NO3Si2 — CID 123879974
3-[4-[bis(2,4,4-trimethyl-3-silyloxypentan-2-yl)amino]phenyl]prop-2-enal (PubChem CID 123879974) has the molecular formula C25H45NO3Si2 and a molecular weight of 463.81 g/mol. Its IUPAC name is 3-[4-[bis(2,4,4-trimethyl-3-silyloxypentan-2-yl)amino]phenyl]prop-2-enal.
| Compound Name | 3-[4-[bis(2,4,4-trimethyl-3-silyloxypentan-2-yl)amino]phenyl]prop-2-enal |
|---|---|
| PubChem CID | 123879974 |
| Molecular Formula | C25H45NO3Si2 |
| Molecular Weight | 463.81 g/mol |
| Exact Mass | 463.29 |
| IUPAC Name | 3-[4-[bis(2,4,4-trimethyl-3-silyloxypentan-2-yl)amino]phenyl]prop-2-enal |
| SMILES | CC(C)(C)C(O[SiH3])C(C)(C)N(c1ccc(C=CC=O)cc1)C(C)(C)C(O[SiH3])C(C)(C)C |
| InChI | InChI=1S/C25H45NO3Si2/c1-22(2,3)20(28-30)24(7,8)26(25(9,10)21(29-31)23(4,5)6)19-15-13-18(14-16-19)12-11-17-27/h11-17,20-21H,1-10,30-31H3 |
| InChIKey | SSVGGPLCSGPQHV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.81 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|