C25H35N3OSi — CID 101239492
2-[3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-ethylamino]phenyl]cyclohex-2-en-1-ylidene]propanedinitrile (PubChem CID 101239492) has the molecular formula C25H35N3OSi and a molecular weight of 421.66 g/mol. Its IUPAC name is 2-[3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-ethylamino]phenyl]cyclohex-2-en-1-ylidene]propanedinitrile.
| Compound Name | 2-[3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-ethylamino]phenyl]cyclohex-2-en-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 101239492 |
| Molecular Formula | C25H35N3OSi |
| Molecular Weight | 421.66 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 2-[3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-ethylamino]phenyl]cyclohex-2-en-1-ylidene]propanedinitrile |
| SMILES | CCN(CCO[Si](C)(C)C(C)(C)C)c1ccc(C2=CC(=C(C#N)C#N)CCC2)cc1 |
| InChI | InChI=1S/C25H35N3OSi/c1-7-28(15-16-29-30(5,6)25(2,3)4)24-13-11-20(12-14-24)21-9-8-10-22(17-21)23(18-26)19-27/h11-14,17H,7-10,15-16H2,1-6H3 |
| InChIKey | HUDVTGWHSFAVOB-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 60.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.66 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|