C24H31ClFN3O4Si — CID 156678309
1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-propan-2-yl-3-pyridinyl]-7-chloro-6-fluoroquinazoline-2,4-dione (PubChem CID 156678309) has the molecular formula C24H31ClFN3O4Si and a molecular weight of 508.07 g/mol. Its IUPAC name is 1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-propan-2-yl-3-pyridinyl]-7-chloro-6-fluoroquinazoline-2,4-dione.
| Compound Name | 1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-propan-2-yl-3-pyridinyl]-7-chloro-6-fluoroquinazoline-2,4-dione |
|---|---|
| PubChem CID | 156678309 |
| Molecular Formula | C24H31ClFN3O4Si |
| Molecular Weight | 508.07 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-propan-2-yl-3-pyridinyl]-7-chloro-6-fluoroquinazoline-2,4-dione |
| SMILES | CC(C)c1nccc(OCCO[Si](C)(C)C(C)(C)C)c1-n1c(=O)[nH]c(=O)c2cc(F)c(Cl)cc21 |
| InChI | InChI=1S/C24H31ClFN3O4Si/c1-14(2)20-21(19(8-9-27-20)32-10-11-33-34(6,7)24(3,4)5)29-18-13-16(25)17(26)12-15(18)22(30)28-23(29)31/h8-9,12-14H,10-11H2,1-7H3,(H,28,30,31) |
| InChIKey | DXOWGKFYMWXXID-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.07 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|