C17H26ClN3O2Si — CID 141450366
6-chloro-N-propan-2-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-3-carboxamide (PubChem CID 141450366) has the molecular formula C17H26ClN3O2Si and a molecular weight of 367.95 g/mol. Its IUPAC name is 6-chloro-N-propan-2-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-propan-2-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 141450366 |
| Molecular Formula | C17H26ClN3O2Si |
| Molecular Weight | 367.95 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 6-chloro-N-propan-2-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-3-carboxamide |
| SMILES | CC(C)NC(=O)c1cn(COCC[Si](C)(C)C)c2nc(Cl)ccc12 |
| InChI | InChI=1S/C17H26ClN3O2Si/c1-12(2)19-17(22)14-10-21(11-23-8-9-24(3,4)5)16-13(14)6-7-15(18)20-16/h6-7,10,12H,8-9,11H2,1-5H3,(H,19,22) |
| InChIKey | YCOWXVJWROUDIK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.95 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|