C27H36N4O4Si — CID 163251486
N-[3-(2,6-dimethoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]-5-azaspiro[2.3]hexane-2-carboxamide (PubChem CID 163251486) has the molecular formula C27H36N4O4Si and a molecular weight of 508.70 g/mol. Its IUPAC name is N-[3-(2,6-dimethoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]-5-azaspiro[2.3]hexane-2-carboxamide.
| Compound Name | N-[3-(2,6-dimethoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]-5-azaspiro[2.3]hexane-2-carboxamide |
|---|---|
| PubChem CID | 163251486 |
| Molecular Formula | C27H36N4O4Si |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | N-[3-(2,6-dimethoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]-5-azaspiro[2.3]hexane-2-carboxamide |
| SMILES | COc1cccc(OC)c1-c1cn(COCC[Si](C)(C)C)c2nc(NC(=O)C3CC34CNC4)ccc12 |
| InChI | InChI=1S/C27H36N4O4Si/c1-33-21-7-6-8-22(34-2)24(21)19-14-31(17-35-11-12-36(3,4)5)25-18(19)9-10-23(29-25)30-26(32)20-13-27(20)15-28-16-27/h6-10,14,20,28H,11-13,15-17H2,1-5H3,(H,29,30,32) |
| InChIKey | MFCLVNYIGKNJRW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|