C26H34FN3O5Si — CID 174055627
N-[3-(2,6-dimethoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]-2-fluoro-3-(hydroxymethyl)cyclopropane-1-carboxamide (PubChem CID 174055627) has the molecular formula C26H34FN3O5Si and a molecular weight of 515.66 g/mol. Its IUPAC name is N-[3-(2,6-dimethoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]-2-fluoro-3-(hydroxymethyl)cyclopropane-1-carboxamide.
| Compound Name | N-[3-(2,6-dimethoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]-2-fluoro-3-(hydroxymethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 174055627 |
| Molecular Formula | C26H34FN3O5Si |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | N-[3-(2,6-dimethoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]-2-fluoro-3-(hydroxymethyl)cyclopropane-1-carboxamide |
| SMILES | COc1cccc(OC)c1-c1cn(COCC[Si](C)(C)C)c2nc(NC(=O)C3C(F)C3CO)ccc12 |
| InChI | InChI=1S/C26H34FN3O5Si/c1-33-19-7-6-8-20(34-2)22(19)17-13-30(15-35-11-12-36(3,4)5)25-16(17)9-10-21(28-25)29-26(32)23-18(14-31)24(23)27/h6-10,13,18,23-24,31H,11-12,14-15H2,1-5H3,(H,28,29,32) |
| InChIKey | OFHVHNFNSGQYIV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|