C22H34N2O4 — CID 124889370
tert-butyl 4-[(2S)-4-oxo-4-(2-phenoxyethylamino)butan-2-yl]piperidine-1-carboxylate (PubChem CID 124889370) has the molecular formula C22H34N2O4 and a molecular weight of 390.52 g/mol. Its IUPAC name is tert-butyl 4-[(2S)-4-oxo-4-(2-phenoxyethylamino)butan-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2S)-4-oxo-4-(2-phenoxyethylamino)butan-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 124889370 |
| Molecular Formula | C22H34N2O4 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | tert-butyl 4-[(2S)-4-oxo-4-(2-phenoxyethylamino)butan-2-yl]piperidine-1-carboxylate |
| SMILES | C[C@@H](CC(=O)NCCOc1ccccc1)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H34N2O4/c1-17(16-20(25)23-12-15-27-19-8-6-5-7-9-19)18-10-13-24(14-11-18)21(26)28-22(2,3)4/h5-9,17-18H,10-16H2,1-4H3,(H,23,25)/t17-/m0/s1 |
| InChIKey | TTWKGWKJLLHGTF-KRWDZBQOSA-N |
| XLogP | 3.85 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|