C19H21ClN4OSi — CID 169097833
4-[6-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-2-yl]pyridine-2-carbonitrile (PubChem CID 169097833) has the molecular formula C19H21ClN4OSi and a molecular weight of 384.94 g/mol. Its IUPAC name is 4-[6-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-2-yl]pyridine-2-carbonitrile.
| Compound Name | 4-[6-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-2-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 169097833 |
| Molecular Formula | C19H21ClN4OSi |
| Molecular Weight | 384.94 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 4-[6-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-2-yl]pyridine-2-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccnc(C#N)c2)cc2cnc(Cl)cc21 |
| InChI | InChI=1S/C19H21ClN4OSi/c1-26(2,3)7-6-25-13-24-17(14-4-5-22-16(8-14)11-21)9-15-12-23-19(20)10-18(15)24/h4-5,8-10,12H,6-7,13H2,1-3H3 |
| InChIKey | JLHRHAUVQSGCMK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.94 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|