C22H28N4O2Si — CID 67362055
2-[[4-(4-methoxyphenyl)-10-methyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl-trimethylsilane (PubChem CID 67362055) has the molecular formula C22H28N4O2Si and a molecular weight of 408.58 g/mol. Its IUPAC name is 2-[[4-(4-methoxyphenyl)-10-methyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-(4-methoxyphenyl)-10-methyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 67362055 |
| Molecular Formula | C22H28N4O2Si |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-[[4-(4-methoxyphenyl)-10-methyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl-trimethylsilane |
| SMILES | COc1ccc(-c2cc3c(ncc4c(C)ncn43)n2COCC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C22H28N4O2Si/c1-16-21-13-23-22-20(25(21)14-24-16)12-19(17-6-8-18(27-2)9-7-17)26(22)15-28-10-11-29(3,4)5/h6-9,12-14H,10-11,15H2,1-5H3 |
| InChIKey | RESDEMOMPBYNJO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 53.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|