C25H36N6OSi — CID 67362929
azane;trimethyl-[2-[[4-(4-methylphenyl)-12-pyrrolidin-1-yl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl]silane (PubChem CID 67362929) has the molecular formula C25H36N6OSi and a molecular weight of 464.69 g/mol. Its IUPAC name is azane;trimethyl-[2-[[4-(4-methylphenyl)-12-pyrrolidin-1-yl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl]silane.
| Compound Name | azane;trimethyl-[2-[[4-(4-methylphenyl)-12-pyrrolidin-1-yl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 67362929 |
| Molecular Formula | C25H36N6OSi |
| Molecular Weight | 464.69 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | azane;trimethyl-[2-[[4-(4-methylphenyl)-12-pyrrolidin-1-yl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl]silane |
| SMILES | Cc1ccc(-c2cc3c(ncc4cnc(N5CCCC5)n43)n2COCC[Si](C)(C)C)cc1.N |
| InChI | InChI=1S/C25H33N5OSi.H3N/c1-19-7-9-20(10-8-19)22-15-23-24(29(22)18-31-13-14-32(2,3)4)26-16-21-17-27-25(30(21)23)28-11-5-6-12-28;/h7-10,15-17H,5-6,11-14,18H2,1-4H3;1H3 |
| InChIKey | OZDZZKLYVNYWFU-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.69 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|