C28H28BrN7 — CID 57400415
9-[[4-[4-[(4-pyrrolidin-1-ylpyridin-1-ium-1-yl)methyl]phenyl]phenyl]methyl]purin-6-amine bromide (PubChem CID 57400415) has the molecular formula C28H28BrN7 and a molecular weight of 542.49 g/mol. Its IUPAC name is 9-[[4-[4-[(4-pyrrolidin-1-ylpyridin-1-ium-1-yl)methyl]phenyl]phenyl]methyl]purin-6-amine bromide.
| Compound Name | 9-[[4-[4-[(4-pyrrolidin-1-ylpyridin-1-ium-1-yl)methyl]phenyl]phenyl]methyl]purin-6-amine bromide |
|---|---|
| PubChem CID | 57400415 |
| Molecular Formula | C28H28BrN7 |
| Molecular Weight | 542.49 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | 9-[[4-[4-[(4-pyrrolidin-1-ylpyridin-1-ium-1-yl)methyl]phenyl]phenyl]methyl]purin-6-amine bromide |
| SMILES | Nc1ncnc2c1ncn2Cc1ccc(-c2ccc(C[n+]3ccc(N4CCCC4)cc3)cc2)cc1.[Br-] |
| InChI | InChI=1S/C28H28N7.BrH/c29-27-26-28(31-19-30-27)35(20-32-26)18-22-5-9-24(10-6-22)23-7-3-21(4-8-23)17-33-15-11-25(12-16-33)34-13-1-2-14-34;/h3-12,15-16,19-20H,1-2,13-14,17-18H2,(H2,29,30,31);1H/q+1;/p-1 |
| InChIKey | WCTVOCDBSMJOPH-UHFFFAOYSA-M |
| XLogP | 1.06 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.49 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|