C19H24ClN3OS — CID 164564728
2-[[6-chloro-2-(2-methyl-4-pyridinyl)pyrrolo[3,2-c]pyridin-1-yl]methoxy]ethyl-trimethyl-λ4-sulfane (PubChem CID 164564728) has the molecular formula C19H24ClN3OS and a molecular weight of 377.94 g/mol. Its IUPAC name is 2-[[6-chloro-2-(2-methyl-4-pyridinyl)pyrrolo[3,2-c]pyridin-1-yl]methoxy]ethyl-trimethyl-λ4-sulfane.
| Compound Name | 2-[[6-chloro-2-(2-methyl-4-pyridinyl)pyrrolo[3,2-c]pyridin-1-yl]methoxy]ethyl-trimethyl-λ4-sulfane |
|---|---|
| PubChem CID | 164564728 |
| Molecular Formula | C19H24ClN3OS |
| Molecular Weight | 377.94 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 2-[[6-chloro-2-(2-methyl-4-pyridinyl)pyrrolo[3,2-c]pyridin-1-yl]methoxy]ethyl-trimethyl-λ4-sulfane |
| SMILES | Cc1cc(-c2cc3cnc(Cl)cc3n2COCCS(C)(C)C)ccn1 |
| InChI | InChI=1S/C19H24ClN3OS/c1-14-9-15(5-6-21-14)17-10-16-12-22-19(20)11-18(16)23(17)13-24-7-8-25(2,3)4/h5-6,9-12H,7-8,13H2,1-4H3 |
| InChIKey | DOZILADZDLUGTF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.94 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|