C9H8ClN5 — CID 106754507
4-chloro-6-(2-methyl-4-pyridinyl)-1,3,5-triazin-2-amine (PubChem CID 106754507) has the molecular formula C9H8ClN5 and a molecular weight of 221.65 g/mol. Its IUPAC name is 4-chloro-6-(2-methyl-4-pyridinyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-(2-methyl-4-pyridinyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 106754507 |
| Molecular Formula | C9H8ClN5 |
| Molecular Weight | 221.65 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 4-chloro-6-(2-methyl-4-pyridinyl)-1,3,5-triazin-2-amine |
| SMILES | Cc1cc(-c2nc(N)nc(Cl)n2)ccn1 |
| InChI | InChI=1S/C9H8ClN5/c1-5-4-6(2-3-12-5)7-13-8(10)15-9(11)14-7/h2-4H,1H3,(H2,11,13,14,15) |
| InChIKey | YRYULMALXQYECD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.65 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |