C12H13ClN4O — CID 83240232
4-chloro-6-(3-propan-2-yloxyphenyl)-1,3,5-triazin-2-amine (PubChem CID 83240232) has the molecular formula C12H13ClN4O and a molecular weight of 264.72 g/mol. Its IUPAC name is 4-chloro-6-(3-propan-2-yloxyphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-(3-propan-2-yloxyphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 83240232 |
| Molecular Formula | C12H13ClN4O |
| Molecular Weight | 264.72 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 4-chloro-6-(3-propan-2-yloxyphenyl)-1,3,5-triazin-2-amine |
| SMILES | CC(C)Oc1cccc(-c2nc(N)nc(Cl)n2)c1 |
| InChI | InChI=1S/C12H13ClN4O/c1-7(2)18-9-5-3-4-8(6-9)10-15-11(13)17-12(14)16-10/h3-7H,1-2H3,(H2,14,15,16,17) |
| InChIKey | YDAYJHQRIYLPTL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.72 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |