C13H11Cl2IN2O — CID 66311636
4,6-dichloro-5-iodo-2-(3-propan-2-yloxyphenyl)pyrimidine (PubChem CID 66311636) has the molecular formula C13H11Cl2IN2O and a molecular weight of 409.05 g/mol. Its IUPAC name is 4,6-dichloro-5-iodo-2-(3-propan-2-yloxyphenyl)pyrimidine.
| Compound Name | 4,6-dichloro-5-iodo-2-(3-propan-2-yloxyphenyl)pyrimidine |
|---|---|
| PubChem CID | 66311636 |
| Molecular Formula | C13H11Cl2IN2O |
| Molecular Weight | 409.05 g/mol |
| Exact Mass | 407.93 |
| IUPAC Name | 4,6-dichloro-5-iodo-2-(3-propan-2-yloxyphenyl)pyrimidine |
| SMILES | CC(C)Oc1cccc(-c2nc(Cl)c(I)c(Cl)n2)c1 |
| InChI | InChI=1S/C13H11Cl2IN2O/c1-7(2)19-9-5-3-4-8(6-9)13-17-11(14)10(16)12(15)18-13/h3-7H,1-2H3 |
| InChIKey | HKSGYTSGKSCNRI-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.05 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|