About 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-6-piperazin-1-yl-7H-purin-8-one
2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-6-piperazin-1-yl-7H-purin-8-one (PubChem CID 67123674) has the molecular formula C21H23FN8O2
and a molecular weight of 438.47 g/mol. Its IUPAC name is 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-6-piperazin-1-yl-7H-purin-8-one.
Molecular Properties
| Compound Name | 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-6-piperazin-1-yl-7H-purin-8-one |
| PubChem CID | 67123674 |
| Molecular Formula | C21H23FN8O2 |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-6-piperazin-1-yl-7H-purin-8-one |
| SMILES | O=c1[nH]c2c(N3CCNCC3)nc(-c3cnc4ccc(F)cn34)nc2n1C1CCOCC1 |
| InChI | InChI=1S/C21H23FN8O2/c22-13-1-2-16-24-11-15(29(16)12-13)18-26-19(28-7-5-23-6-8-28)17-20(27-18)30(21(31)25-17)14-3-9-32-10-4-14/h1-2,11-12,14,23H,3-10H2,(H,25,31) |
| InChIKey | OBJRCYZMSOGKRH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 105.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-6-piperazin-1-yl-7H-purin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-6-piperazin-1-yl-7H-purin-8-one?
The IUPAC name of 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-6-piperazin-1-yl-7H-purin-8-one (CID 67123674) is 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-6-piperazin-1-yl-7H-purin-8-one.
What is the SMILES notation for 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-6-piperazin-1-yl-7H-purin-8-one?
The canonical SMILES for 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-6-piperazin-1-yl-7H-purin-8-one is O=c1[nH]c2c(N3CCNCC3)nc(-c3cnc4ccc(F)cn34)nc2n1C1CCOCC1.
What is the InChIKey of 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-6-piperazin-1-yl-7H-purin-8-one?
The InChIKey is OBJRCYZMSOGKRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23FN8O2/c22-13-1-2-16-24-11-15(29(16)12-13)18-26-19(28-7-5-23-6-8-28)17-20(27-18)30(21(31)25-17)14-3-9-32-10-4-14/h1-2,11-12,14,23H,3-10H2,(H,25,31).
What are the key properties of 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-6-piperazin-1-yl-7H-purin-8-one?
2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-6-piperazin-1-yl-7H-purin-8-one has a molecular weight of 438.47 g/mol, XLogP of 1.33, 3 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-6-piperazin-1-yl-7H-purin-8-one is sourced from PubChem (CID 67123674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).