C20H25N7O4 — CID 71062050
2-[(2-methoxy-3-pyridinyl)amino]-6-morpholin-4-yl-9-(oxan-4-yl)-7H-purin-8-one (PubChem CID 71062050) has the molecular formula C20H25N7O4 and a molecular weight of 427.47 g/mol. Its IUPAC name is 2-[(2-methoxy-3-pyridinyl)amino]-6-morpholin-4-yl-9-(oxan-4-yl)-7H-purin-8-one.
| Compound Name | 2-[(2-methoxy-3-pyridinyl)amino]-6-morpholin-4-yl-9-(oxan-4-yl)-7H-purin-8-one |
|---|---|
| PubChem CID | 71062050 |
| Molecular Formula | C20H25N7O4 |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 2-[(2-methoxy-3-pyridinyl)amino]-6-morpholin-4-yl-9-(oxan-4-yl)-7H-purin-8-one |
| SMILES | COc1ncccc1Nc1nc(N2CCOCC2)c2[nH]c(=O)n(C3CCOCC3)c2n1 |
| InChI | InChI=1S/C20H25N7O4/c1-29-18-14(3-2-6-21-18)22-19-24-16(26-7-11-31-12-8-26)15-17(25-19)27(20(28)23-15)13-4-9-30-10-5-13/h2-3,6,13H,4-5,7-12H2,1H3,(H,23,28)(H,22,24,25) |
| InChIKey | REOMVOFFGUAJIH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 119.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |