C18H22N6O3 — CID 71061998
2-[(2-methoxy-3-pyridinyl)-methylamino]-7-methyl-9-(oxan-4-yl)purin-8-one (PubChem CID 71061998) has the molecular formula C18H22N6O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-[(2-methoxy-3-pyridinyl)-methylamino]-7-methyl-9-(oxan-4-yl)purin-8-one.
| Compound Name | 2-[(2-methoxy-3-pyridinyl)-methylamino]-7-methyl-9-(oxan-4-yl)purin-8-one |
|---|---|
| PubChem CID | 71061998 |
| Molecular Formula | C18H22N6O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 2-[(2-methoxy-3-pyridinyl)-methylamino]-7-methyl-9-(oxan-4-yl)purin-8-one |
| SMILES | COc1ncccc1N(C)c1ncc2c(n1)n(C1CCOCC1)c(=O)n2C |
| InChI | InChI=1S/C18H22N6O3/c1-22(13-5-4-8-19-16(13)26-3)17-20-11-14-15(21-17)24(18(25)23(14)2)12-6-9-27-10-7-12/h4-5,8,11-12H,6-7,9-10H2,1-3H3 |
| InChIKey | MUHBATKSCLQFNX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 87.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |