C21H25N5O3 — CID 163381699
4-[1-[(2-methoxy-3-pyridinyl)methyl]piperidin-4-yl]-1,6-dimethylpyrido[2,3-b]pyrazine-2,3-dione (PubChem CID 163381699) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 4-[1-[(2-methoxy-3-pyridinyl)methyl]piperidin-4-yl]-1,6-dimethylpyrido[2,3-b]pyrazine-2,3-dione.
| Compound Name | 4-[1-[(2-methoxy-3-pyridinyl)methyl]piperidin-4-yl]-1,6-dimethylpyrido[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 163381699 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 4-[1-[(2-methoxy-3-pyridinyl)methyl]piperidin-4-yl]-1,6-dimethylpyrido[2,3-b]pyrazine-2,3-dione |
| SMILES | COc1ncccc1CN1CCC(n2c(=O)c(=O)n(C)c3ccc(C)nc32)CC1 |
| InChI | InChI=1S/C21H25N5O3/c1-14-6-7-17-18(23-14)26(21(28)20(27)24(17)2)16-8-11-25(12-9-16)13-15-5-4-10-22-19(15)29-3/h4-7,10,16H,8-9,11-13H2,1-3H3 |
| InChIKey | JFBZAPVAPWZIFB-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 82.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|