C18H19N7O2 — CID 90218239
2-[2-[(2-methoxy-3-pyridinyl)amino]-8-oxo-7H-purin-9-yl]cyclohexane-1-carbonitrile (PubChem CID 90218239) has the molecular formula C18H19N7O2 and a molecular weight of 365.40 g/mol. Its IUPAC name is 2-[2-[(2-methoxy-3-pyridinyl)amino]-8-oxo-7H-purin-9-yl]cyclohexane-1-carbonitrile.
| Compound Name | 2-[2-[(2-methoxy-3-pyridinyl)amino]-8-oxo-7H-purin-9-yl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 90218239 |
| Molecular Formula | C18H19N7O2 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 2-[2-[(2-methoxy-3-pyridinyl)amino]-8-oxo-7H-purin-9-yl]cyclohexane-1-carbonitrile |
| SMILES | COc1ncccc1Nc1ncc2[nH]c(=O)n(C3CCCCC3C#N)c2n1 |
| InChI | InChI=1S/C18H19N7O2/c1-27-16-12(6-4-8-20-16)22-17-21-10-13-15(24-17)25(18(26)23-13)14-7-3-2-5-11(14)9-19/h4,6,8,10-11,14H,2-3,5,7H2,1H3,(H,23,26)(H,21,22,24) |
| InChIKey | GMCXAAMVJLYVDQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 121.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |