C17H17N7O2 — CID 123299577
1-[8-oxo-2-[(2-oxo-1H-pyridin-3-yl)amino]-7H-purin-9-yl]cyclohexane-1-carbonitrile (PubChem CID 123299577) has the molecular formula C17H17N7O2 and a molecular weight of 351.37 g/mol. Its IUPAC name is 1-[8-oxo-2-[(2-oxo-1H-pyridin-3-yl)amino]-7H-purin-9-yl]cyclohexane-1-carbonitrile.
| Compound Name | 1-[8-oxo-2-[(2-oxo-1H-pyridin-3-yl)amino]-7H-purin-9-yl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 123299577 |
| Molecular Formula | C17H17N7O2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 1-[8-oxo-2-[(2-oxo-1H-pyridin-3-yl)amino]-7H-purin-9-yl]cyclohexane-1-carbonitrile |
| SMILES | N#CC1(n2c(=O)[nH]c3cnc(Nc4ccc[nH]c4=O)nc32)CCCCC1 |
| InChI | InChI=1S/C17H17N7O2/c18-10-17(6-2-1-3-7-17)24-13-12(22-16(24)26)9-20-15(23-13)21-11-5-4-8-19-14(11)25/h4-5,8-9H,1-3,6-7H2,(H,19,25)(H,22,26)(H,20,21,23) |
| InChIKey | ZHKNNCCBUFYVAN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 132.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |