C20H21N7 — CID 158308668
N-(1H-pyrrol-2-yl)spiro[3,6,9,11,13-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2,4,10,12,14-hexaene-8,1'-cyclohexane]-12-amine (PubChem CID 158308668) has the molecular formula C20H21N7 and a molecular weight of 359.44 g/mol. Its IUPAC name is N-(1H-pyrrol-2-yl)spiro[3,6,9,11,13-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2,4,10,12,14-hexaene-8,1'-cyclohexane]-12-amine.
| Compound Name | N-(1H-pyrrol-2-yl)spiro[3,6,9,11,13-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2,4,10,12,14-hexaene-8,1'-cyclohexane]-12-amine |
|---|---|
| PubChem CID | 158308668 |
| Molecular Formula | C20H21N7 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | N-(1H-pyrrol-2-yl)spiro[3,6,9,11,13-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2,4,10,12,14-hexaene-8,1'-cyclohexane]-12-amine |
| SMILES | c1c[nH]c(Nc2ncc3cc4n(c3n2)C2(CCCCC2)Cn2ccnc2-4)c1 |
| InChI | InChI=1S/C20H21N7/c1-2-6-20(7-3-1)13-26-10-9-22-18(26)15-11-14-12-23-19(25-17(14)27(15)20)24-16-5-4-8-21-16/h4-5,8-12,21H,1-3,6-7,13H2,(H,23,24,25) |
| InChIKey | GNKHKHAIZXYSGL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |