C26H38N6O2 — CID 162103870
11-methyl-4-[[4-(oxan-4-ylamino)cyclohexyl]amino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-10-one (PubChem CID 162103870) has the molecular formula C26H38N6O2 and a molecular weight of 466.63 g/mol. Its IUPAC name is 11-methyl-4-[[4-(oxan-4-ylamino)cyclohexyl]amino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-10-one.
| Compound Name | 11-methyl-4-[[4-(oxan-4-ylamino)cyclohexyl]amino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-10-one |
|---|---|
| PubChem CID | 162103870 |
| Molecular Formula | C26H38N6O2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | 11-methyl-4-[[4-(oxan-4-ylamino)cyclohexyl]amino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-10-one |
| SMILES | CN1CC2(CCCCC2)n2c(cc3cnc(NC4CCC(NC5CCOCC5)CC4)nc32)C1=O |
| InChI | InChI=1S/C26H38N6O2/c1-31-17-26(11-3-2-4-12-26)32-22(24(31)33)15-18-16-27-25(30-23(18)32)29-20-7-5-19(6-8-20)28-21-9-13-34-14-10-21/h15-16,19-21,28H,2-14,17H2,1H3,(H,27,29,30) |
| InChIKey | LICJTDBCCUTKLF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |