About US10233188, Example 96
US10233188, Example 96 (PubChem CID 134257192) has the molecular formula C24H36N6O5S
and a molecular weight of 520.60 g/mol. Its IUPAC name is 4-[[8-[(1R,2R)-2-hydroxy-2-methylcyclopentyl]-6-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]-N-(oxan-4-yl)piperidine-1-sulfonamide.
Molecular Properties
| Compound Name | US10233188, Example 96 |
| PubChem CID | 134257192 |
| Molecular Formula | C24H36N6O5S |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | 4-[[8-[(1R,2R)-2-hydroxy-2-methylcyclopentyl]-6-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]-N-(oxan-4-yl)piperidine-1-sulfonamide |
| SMILES | CC1=CC2=CN=C(N=C2N(C1=O)[C@@H]3CCC[C@@]3(C)O)NC4CCN(CC4)S(=O)(=O)NC5CCOCC5 |
| InChI | InChI=1S/C24H36N6O5S/c1-16-14-17-15-25-23(27-21(17)30(22(16)31)20-4-3-9-24(20,2)32)26-18-5-10-29(11-6-18)36(33,34)28-19-7-12-35-13-8-19/h14-15,18-20,28,32H,3-13H2,1-2H3,(H,25,26,27)/t20-,24-/m1/s1 |
| InChIKey | CWXXTQWYYXYXTG-HYBUGGRVSA-N |
| XLogP | 1.30 |
| TPSA | 145.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | 943 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze US10233188, Example 96 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US10233188, Example 96?
The IUPAC name of US10233188, Example 96 (CID 134257192) is 4-[[8-[(1R,2R)-2-hydroxy-2-methylcyclopentyl]-6-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]-N-(oxan-4-yl)piperidine-1-sulfonamide.
What is the SMILES notation for US10233188, Example 96?
The canonical SMILES for US10233188, Example 96 is CC1=CC2=CN=C(N=C2N(C1=O)[C@@H]3CCC[C@@]3(C)O)NC4CCN(CC4)S(=O)(=O)NC5CCOCC5.
What is the InChIKey of US10233188, Example 96?
The InChIKey is CWXXTQWYYXYXTG-HYBUGGRVSA-N. The full InChI is InChI=1S/C24H36N6O5S/c1-16-14-17-15-25-23(27-21(17)30(22(16)31)20-4-3-9-24(20,2)32)26-18-5-10-29(11-6-18)36(33,34)28-19-7-12-35-13-8-19/h14-15,18-20,28,32H,3-13H2,1-2H3,(H,25,26,27)/t20-,24-/m1/s1.
What are the key properties of US10233188, Example 96?
US10233188, Example 96 has a molecular weight of 520.60 g/mol, XLogP of 1.30, 6 rotatable bonds, 3 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for US10233188, Example 96 is sourced from PubChem (CID 134257192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).