C20H26BF2N5O4S — CID 174093131
CID 174093131 (PubChem CID 174093131) has the molecular formula C20H26BF2N5O4S and a molecular weight of 481.33 g/mol.
| Compound Name | CID 174093131 |
|---|---|
| PubChem CID | 174093131 |
| Molecular Formula | C20H26BF2N5O4S |
| Molecular Weight | 481.33 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | — |
| SMILES | [B]C(F)(F)c1cc2cnc(NC3CCN(S(C)(=O)=O)CC3)nc2n(C2CCCC2(C)O)c1=O |
| InChI | InChI=1S/C20H26BF2N5O4S/c1-19(30)7-3-4-15(19)28-16-12(10-14(17(28)29)20(21,22)23)11-24-18(26-16)25-13-5-8-27(9-6-13)33(2,31)32/h10-11,13,15,30H,3-9H2,1-2H3,(H,24,25,26) |
| InChIKey | ZDUJHZNPTCFEEX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|