C20H29N5O4S — CID 169009380
8-[(1S,2S)-2-hydroxy-2-methylcyclopentyl]-2-[(3,3,4,5,5-pentadeuterio-1-methylsulfonylpiperidin-4-yl)amino]-6-(trideuteriomethyl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 169009380) has the molecular formula C20H29N5O4S and a molecular weight of 443.60 g/mol. Its IUPAC name is 8-[(1S,2S)-2-hydroxy-2-methylcyclopentyl]-2-[(3,3,4,5,5-pentadeuterio-1-methylsulfonylpiperidin-4-yl)amino]-6-(trideuteriomethyl)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-[(1S,2S)-2-hydroxy-2-methylcyclopentyl]-2-[(3,3,4,5,5-pentadeuterio-1-methylsulfonylpiperidin-4-yl)amino]-6-(trideuteriomethyl)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 169009380 |
| Molecular Formula | C20H29N5O4S |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 8-[(1S,2S)-2-hydroxy-2-methylcyclopentyl]-2-[(3,3,4,5,5-pentadeuterio-1-methylsulfonylpiperidin-4-yl)amino]-6-(trideuteriomethyl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | [2H]C([2H])([2H])c1cc2cnc(NC3([2H])C([2H])([2H])CN(S(C)(=O)=O)CC3([2H])[2H])nc2n([C@H]2CCC[C@]2(C)O)c1=O |
| InChI | InChI=1S/C20H29N5O4S/c1-13-11-14-12-21-19(22-15-6-9-24(10-7-15)30(3,28)29)23-17(14)25(18(13)26)16-5-4-8-20(16,2)27/h11-12,15-16,27H,4-10H2,1-3H3,(H,21,22,23)/t16-,20-/m0/s1/i1D3,6D2,7D2,15D |
| InChIKey | APLCQEOLIQVWQN-SIQVQETJSA-N |
| XLogP | 1.41 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |