C20H28IN5O4S — CID 166888885
8-[(1S,2R)-2-hydroxy-5-iodo-2-methylcyclopentyl]-6-methyl-2-[(1-methylsulfonylpiperidin-4-yl)amino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 166888885) has the molecular formula C20H28IN5O4S and a molecular weight of 561.45 g/mol. Its IUPAC name is 8-[(1S,2R)-2-hydroxy-5-iodo-2-methylcyclopentyl]-6-methyl-2-[(1-methylsulfonylpiperidin-4-yl)amino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-[(1S,2R)-2-hydroxy-5-iodo-2-methylcyclopentyl]-6-methyl-2-[(1-methylsulfonylpiperidin-4-yl)amino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 166888885 |
| Molecular Formula | C20H28IN5O4S |
| Molecular Weight | 561.45 g/mol |
| Exact Mass | 561.09 |
| IUPAC Name | 8-[(1S,2R)-2-hydroxy-5-iodo-2-methylcyclopentyl]-6-methyl-2-[(1-methylsulfonylpiperidin-4-yl)amino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1cc2cnc(NC3CCN(S(C)(=O)=O)CC3)nc2n([C@@H]2C(I)CC[C@@]2(C)O)c1=O |
| InChI | InChI=1S/C20H28IN5O4S/c1-12-10-13-11-22-19(23-14-5-8-25(9-6-14)31(3,29)30)24-17(13)26(18(12)27)16-15(21)4-7-20(16,2)28/h10-11,14-16,28H,4-9H2,1-3H3,(H,22,23,24)/t15?,16-,20-/m1/s1 |
| InChIKey | OEZNLBSGVZLODK-KOIGGSBLSA-N |
| XLogP | 1.83 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|