C20H24FN5O3S — CID 170158909
6-fluoro-2-[(1-methylsulfonylpiperidin-4-yl)amino]-8-spiro[2.4]hept-4-en-7-ylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 170158909) has the molecular formula C20H24FN5O3S and a molecular weight of 433.51 g/mol. Its IUPAC name is 6-fluoro-2-[(1-methylsulfonylpiperidin-4-yl)amino]-8-spiro[2.4]hept-4-en-7-ylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-fluoro-2-[(1-methylsulfonylpiperidin-4-yl)amino]-8-spiro[2.4]hept-4-en-7-ylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 170158909 |
| Molecular Formula | C20H24FN5O3S |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 6-fluoro-2-[(1-methylsulfonylpiperidin-4-yl)amino]-8-spiro[2.4]hept-4-en-7-ylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CS(=O)(=O)N1CCC(Nc2ncc3cc(F)c(=O)n(C4CC=CC45CC5)c3n2)CC1 |
| InChI | InChI=1S/C20H24FN5O3S/c1-30(28,29)25-9-4-14(5-10-25)23-19-22-12-13-11-15(21)18(27)26(17(13)24-19)16-3-2-6-20(16)7-8-20/h2,6,11-12,14,16H,3-5,7-10H2,1H3,(H,22,23,24) |
| InChIKey | DMAILYLNSBWMKI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|