C20H28FN5O4S — CID 169009355
8-[(1S,2S,5R)-2-fluoro-5-hydroxycyclohexyl]-2-[(3,3,4,5,5-pentadeuterio-1-methylsulfonylpiperidin-4-yl)amino]-6-(trideuteriomethyl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 169009355) has the molecular formula C20H28FN5O4S and a molecular weight of 461.59 g/mol. Its IUPAC name is 8-[(1S,2S,5R)-2-fluoro-5-hydroxycyclohexyl]-2-[(3,3,4,5,5-pentadeuterio-1-methylsulfonylpiperidin-4-yl)amino]-6-(trideuteriomethyl)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-[(1S,2S,5R)-2-fluoro-5-hydroxycyclohexyl]-2-[(3,3,4,5,5-pentadeuterio-1-methylsulfonylpiperidin-4-yl)amino]-6-(trideuteriomethyl)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 169009355 |
| Molecular Formula | C20H28FN5O4S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 8-[(1S,2S,5R)-2-fluoro-5-hydroxycyclohexyl]-2-[(3,3,4,5,5-pentadeuterio-1-methylsulfonylpiperidin-4-yl)amino]-6-(trideuteriomethyl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | [2H]C([2H])([2H])c1cc2cnc(NC3([2H])C([2H])([2H])CN(S(C)(=O)=O)CC3([2H])[2H])nc2n([C@H]2C[C@H](O)CC[C@@H]2F)c1=O |
| InChI | InChI=1S/C20H28FN5O4S/c1-12-9-13-11-22-20(23-14-5-7-25(8-6-14)31(2,29)30)24-18(13)26(19(12)28)17-10-15(27)3-4-16(17)21/h9,11,14-17,27H,3-8,10H2,1-2H3,(H,22,23,24)/t15-,16+,17+/m1/s1/i1D3,5D2,6D2,14D |
| InChIKey | RLMSDUOEXNRFKG-XZLLNDORSA-N |
| XLogP | 1.36 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |