C20H26F3N5O4S — CID 169009251
6-[deuterio(difluoro)methyl]-8-[(1S,2S,5R)-2-fluoro-5-hydroxycyclohexyl]-2-[(3,3,5,5-tetradeuterio-1-methylsulfonylpiperidin-4-yl)amino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 169009251) has the molecular formula C20H26F3N5O4S and a molecular weight of 494.55 g/mol. Its IUPAC name is 6-[deuterio(difluoro)methyl]-8-[(1S,2S,5R)-2-fluoro-5-hydroxycyclohexyl]-2-[(3,3,5,5-tetradeuterio-1-methylsulfonylpiperidin-4-yl)amino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-[deuterio(difluoro)methyl]-8-[(1S,2S,5R)-2-fluoro-5-hydroxycyclohexyl]-2-[(3,3,5,5-tetradeuterio-1-methylsulfonylpiperidin-4-yl)amino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 169009251 |
| Molecular Formula | C20H26F3N5O4S |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 6-[deuterio(difluoro)methyl]-8-[(1S,2S,5R)-2-fluoro-5-hydroxycyclohexyl]-2-[(3,3,5,5-tetradeuterio-1-methylsulfonylpiperidin-4-yl)amino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | [2H]C(F)(F)c1cc2cnc(NC3C([2H])([2H])CN(S(C)(=O)=O)CC3([2H])[2H])nc2n([C@H]2C[C@H](O)CC[C@@H]2F)c1=O |
| InChI | InChI=1S/C20H26F3N5O4S/c1-33(31,32)27-6-4-12(5-7-27)25-20-24-10-11-8-14(17(22)23)19(30)28(18(11)26-20)16-9-13(29)2-3-15(16)21/h8,10,12-13,15-17,29H,2-7,9H2,1H3,(H,24,25,26)/t13-,15+,16+/m1/s1/i4D2,5D2,17D |
| InChIKey | DDJJYBCITPAOOE-QNTICZMLSA-N |
| XLogP | 1.99 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |