About 8-methyl-2-(oxan-4-ylamino)-6-phenoxypyrido[2,3-d]pyrimidin-7-one;hydrochloride
8-methyl-2-(oxan-4-ylamino)-6-phenoxypyrido[2,3-d]pyrimidin-7-one;hydrochloride (PubChem CID 162321776) has the molecular formula C19H21ClN4O3
and a molecular weight of 388.86 g/mol. Its IUPAC name is 8-methyl-2-(oxan-4-ylamino)-6-phenoxypyrido[2,3-d]pyrimidin-7-one;hydrochloride.
Molecular Properties
| Compound Name | 8-methyl-2-(oxan-4-ylamino)-6-phenoxypyrido[2,3-d]pyrimidin-7-one;hydrochloride |
| PubChem CID | 162321776 |
| Molecular Formula | C19H21ClN4O3 |
| Molecular Weight | 388.86 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 8-methyl-2-(oxan-4-ylamino)-6-phenoxypyrido[2,3-d]pyrimidin-7-one;hydrochloride |
| SMILES | Cl.Cn1c(=O)c(Oc2ccccc2)cc2cnc(NC3CCOCC3)nc21 |
| InChI | InChI=1S/C19H20N4O3.ClH/c1-23-17-13(11-16(18(23)24)26-15-5-3-2-4-6-15)12-20-19(22-17)21-14-7-9-25-10-8-14;/h2-6,11-12,14H,7-10H2,1H3,(H,20,21,22);1H |
| InChIKey | RYQHEBCPKBMKEL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.86 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 8-methyl-2-(oxan-4-ylamino)-6-phenoxypyrido[2,3-d]pyrimidin-7-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-2-(oxan-4-ylamino)-6-phenoxypyrido[2,3-d]pyrimidin-7-one;hydrochloride?
The IUPAC name of 8-methyl-2-(oxan-4-ylamino)-6-phenoxypyrido[2,3-d]pyrimidin-7-one;hydrochloride (CID 162321776) is 8-methyl-2-(oxan-4-ylamino)-6-phenoxypyrido[2,3-d]pyrimidin-7-one;hydrochloride.
What is the SMILES notation for 8-methyl-2-(oxan-4-ylamino)-6-phenoxypyrido[2,3-d]pyrimidin-7-one;hydrochloride?
The canonical SMILES for 8-methyl-2-(oxan-4-ylamino)-6-phenoxypyrido[2,3-d]pyrimidin-7-one;hydrochloride is Cl.Cn1c(=O)c(Oc2ccccc2)cc2cnc(NC3CCOCC3)nc21.
What is the InChIKey of 8-methyl-2-(oxan-4-ylamino)-6-phenoxypyrido[2,3-d]pyrimidin-7-one;hydrochloride?
The InChIKey is RYQHEBCPKBMKEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O3.ClH/c1-23-17-13(11-16(18(23)24)26-15-5-3-2-4-6-15)12-20-19(22-17)21-14-7-9-25-10-8-14;/h2-6,11-12,14H,7-10H2,1H3,(H,20,21,22);1H.
What are the key properties of 8-methyl-2-(oxan-4-ylamino)-6-phenoxypyrido[2,3-d]pyrimidin-7-one;hydrochloride?
8-methyl-2-(oxan-4-ylamino)-6-phenoxypyrido[2,3-d]pyrimidin-7-one;hydrochloride has a molecular weight of 388.86 g/mol, XLogP of 3.13, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-2-(oxan-4-ylamino)-6-phenoxypyrido[2,3-d]pyrimidin-7-one;hydrochloride is sourced from PubChem (CID 162321776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).