C34H31F2N7O7S — CID 159882081
6-(2-fluorophenoxy)-8-methyl-2-methylperoxysulfanylpyrido[2,3-d]pyrimidin-7-one;6-(2-fluorophenoxy)-8-methyl-2-(oxan-4-ylamino)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 159882081) has the molecular formula C34H31F2N7O7S and a molecular weight of 719.73 g/mol. Its IUPAC name is 6-(2-fluorophenoxy)-8-methyl-2-methylperoxysulfanylpyrido[2,3-d]pyrimidin-7-one;6-(2-fluorophenoxy)-8-methyl-2-(oxan-4-ylamino)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(2-fluorophenoxy)-8-methyl-2-methylperoxysulfanylpyrido[2,3-d]pyrimidin-7-one;6-(2-fluorophenoxy)-8-methyl-2-(oxan-4-ylamino)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 159882081 |
| Molecular Formula | C34H31F2N7O7S |
| Molecular Weight | 719.73 g/mol |
| Exact Mass | 719.20 |
| IUPAC Name | 6-(2-fluorophenoxy)-8-methyl-2-methylperoxysulfanylpyrido[2,3-d]pyrimidin-7-one;6-(2-fluorophenoxy)-8-methyl-2-(oxan-4-ylamino)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | COOSc1ncc2cc(Oc3ccccc3F)c(=O)n(C)c2n1.Cn1c(=O)c(Oc2ccccc2F)cc2cnc(NC3CCOCC3)nc21 |
| InChI | InChI=1S/C19H19FN4O3.C15H12FN3O4S/c1-24-17-12(11-21-19(23-17)22-13-6-8-26-9-7-13)10-16(18(24)25)27-15-5-3-2-4-14(15)20;1-19-13-9(8-17-15(18-13)24-23-21-2)7-12(14(19)20)22-11-6-4-3-5-10(11)16/h2-5,10-11,13H,6-9H2,1H3,(H,21,22,23);3-8H,1-2H3 |
| InChIKey | NTQNVTQRSODFOA-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 153.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.73 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|