C30H22F4N6O6S2 — CID 158804346
6-(2,6-difluorophenoxy)-8-methyl-2-methylperoxysulfanylpyrido[2,3-d]pyrimidin-7-one;6-(2,6-difluorophenoxy)-8-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 158804346) has the molecular formula C30H22F4N6O6S2 and a molecular weight of 702.67 g/mol. Its IUPAC name is 6-(2,6-difluorophenoxy)-8-methyl-2-methylperoxysulfanylpyrido[2,3-d]pyrimidin-7-one;6-(2,6-difluorophenoxy)-8-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(2,6-difluorophenoxy)-8-methyl-2-methylperoxysulfanylpyrido[2,3-d]pyrimidin-7-one;6-(2,6-difluorophenoxy)-8-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 158804346 |
| Molecular Formula | C30H22F4N6O6S2 |
| Molecular Weight | 702.67 g/mol |
| Exact Mass | 702.10 |
| IUPAC Name | 6-(2,6-difluorophenoxy)-8-methyl-2-methylperoxysulfanylpyrido[2,3-d]pyrimidin-7-one;6-(2,6-difluorophenoxy)-8-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | COOSc1ncc2cc(Oc3c(F)cccc3F)c(=O)n(C)c2n1.CSc1ncc2cc(Oc3c(F)cccc3F)c(=O)n(C)c2n1 |
| InChI | InChI=1S/C15H11F2N3O4S.C15H11F2N3O2S/c1-20-13-8(7-18-15(19-13)25-24-22-2)6-11(14(20)21)23-12-9(16)4-3-5-10(12)17;1-20-13-8(7-18-15(19-13)23-2)6-11(14(20)21)22-12-9(16)4-3-5-10(12)17/h3-7H,1-2H3;3-7H,1-2H3 |
| InChIKey | ITWNKOJXQCCMPZ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 132.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.67 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|