C37H31Cl2N7O6S — CID 159285545
6-(2-chlorophenoxy)-8-methyl-2-methylperoxysulfanylpyrido[2,3-d]pyrimidin-7-one;6-(2-chlorophenoxy)-8-methyl-2-(2-phenylethylamino)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 159285545) has the molecular formula C37H31Cl2N7O6S and a molecular weight of 772.67 g/mol. Its IUPAC name is 6-(2-chlorophenoxy)-8-methyl-2-methylperoxysulfanylpyrido[2,3-d]pyrimidin-7-one;6-(2-chlorophenoxy)-8-methyl-2-(2-phenylethylamino)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(2-chlorophenoxy)-8-methyl-2-methylperoxysulfanylpyrido[2,3-d]pyrimidin-7-one;6-(2-chlorophenoxy)-8-methyl-2-(2-phenylethylamino)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 159285545 |
| Molecular Formula | C37H31Cl2N7O6S |
| Molecular Weight | 772.67 g/mol |
| Exact Mass | 771.14 |
| IUPAC Name | 6-(2-chlorophenoxy)-8-methyl-2-methylperoxysulfanylpyrido[2,3-d]pyrimidin-7-one;6-(2-chlorophenoxy)-8-methyl-2-(2-phenylethylamino)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | COOSc1ncc2cc(Oc3ccccc3Cl)c(=O)n(C)c2n1.Cn1c(=O)c(Oc2ccccc2Cl)cc2cnc(NCCc3ccccc3)nc21 |
| InChI | InChI=1S/C22H19ClN4O2.C15H12ClN3O4S/c1-27-20-16(13-19(21(27)28)29-18-10-6-5-9-17(18)23)14-25-22(26-20)24-12-11-15-7-3-2-4-8-15;1-19-13-9(8-17-15(18-13)24-23-21-2)7-12(14(19)20)22-11-6-4-3-5-10(11)16/h2-10,13-14H,11-12H2,1H3,(H,24,25,26);3-8H,1-2H3 |
| InChIKey | KZLRFYKHRLQPSH-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 144.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.67 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|