C15H11F2N3O4S — CID 20626911
6-(2,4-difluorophenoxy)-8-methyl-2-methylperoxysulfanylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 20626911) has the molecular formula C15H11F2N3O4S and a molecular weight of 367.33 g/mol. Its IUPAC name is 6-(2,4-difluorophenoxy)-8-methyl-2-methylperoxysulfanylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(2,4-difluorophenoxy)-8-methyl-2-methylperoxysulfanylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 20626911 |
| Molecular Formula | C15H11F2N3O4S |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 6-(2,4-difluorophenoxy)-8-methyl-2-methylperoxysulfanylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | COOSc1ncc2cc(Oc3ccc(F)cc3F)c(=O)n(C)c2n1 |
| InChI | InChI=1S/C15H11F2N3O4S/c1-20-13-8(7-18-15(19-13)25-24-22-2)5-12(14(20)21)23-11-4-3-9(16)6-10(11)17/h3-7H,1-2H3 |
| InChIKey | VBJKBRKEFUDWET-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|