C14H9F2N3O2S — CID 71053344
6-(2,4-difluorophenoxy)-8-methyl-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 71053344) has the molecular formula C14H9F2N3O2S and a molecular weight of 321.31 g/mol. Its IUPAC name is 6-(2,4-difluorophenoxy)-8-methyl-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(2,4-difluorophenoxy)-8-methyl-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 71053344 |
| Molecular Formula | C14H9F2N3O2S |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 6-(2,4-difluorophenoxy)-8-methyl-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cn1c(=O)c(Oc2ccc(F)cc2F)cc2cnc(=S)[nH]c21 |
| InChI | InChI=1S/C14H9F2N3O2S/c1-19-12-7(6-17-14(22)18-12)4-11(13(19)20)21-10-3-2-8(15)5-9(10)16/h2-6H,1H3,(H,17,18,22) |
| InChIKey | POBGEEZIIXOORA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|