C25H33N7O — CID 170078241
4-[[5-[butyl(propyl)amino]-2-pyridinyl]amino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclopentane]-10-one (PubChem CID 170078241) has the molecular formula C25H33N7O and a molecular weight of 447.59 g/mol. Its IUPAC name is 4-[[5-[butyl(propyl)amino]-2-pyridinyl]amino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclopentane]-10-one.
| Compound Name | 4-[[5-[butyl(propyl)amino]-2-pyridinyl]amino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclopentane]-10-one |
|---|---|
| PubChem CID | 170078241 |
| Molecular Formula | C25H33N7O |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | 4-[[5-[butyl(propyl)amino]-2-pyridinyl]amino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclopentane]-10-one |
| SMILES | CCCCN(CCC)c1ccc(Nc2ncc3cc4n(c3n2)C2(CCCC2)CNC4=O)nc1 |
| InChI | InChI=1S/C25H33N7O/c1-3-5-13-31(12-4-2)19-8-9-21(26-16-19)29-24-27-15-18-14-20-23(33)28-17-25(10-6-7-11-25)32(20)22(18)30-24/h8-9,14-16H,3-7,10-13,17H2,1-2H3,(H,28,33)(H,26,27,29,30) |
| InChIKey | NLDMQRUPLQPARW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |