C24H29N7O3S — CID 162360085
4-(4-piperazin-1-ylsulfonylanilino)spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-10-one (PubChem CID 162360085) has the molecular formula C24H29N7O3S and a molecular weight of 495.61 g/mol. Its IUPAC name is 4-(4-piperazin-1-ylsulfonylanilino)spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-10-one.
| Compound Name | 4-(4-piperazin-1-ylsulfonylanilino)spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-10-one |
|---|---|
| PubChem CID | 162360085 |
| Molecular Formula | C24H29N7O3S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 4-(4-piperazin-1-ylsulfonylanilino)spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-10-one |
| SMILES | O=C1NCC2(CCCCC2)n2c1cc1cnc(Nc3ccc(S(=O)(=O)N4CCNCC4)cc3)nc12 |
| InChI | InChI=1S/C24H29N7O3S/c32-22-20-14-17-15-26-23(29-21(17)31(20)24(16-27-22)8-2-1-3-9-24)28-18-4-6-19(7-5-18)35(33,34)30-12-10-25-11-13-30/h4-7,14-15,25H,1-3,8-13,16H2,(H,27,32)(H,26,28,29) |
| InChIKey | RNQSBYGRTPLECJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 121.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |