C25H31N7O4S — CID 162360335
10-hydroxy-4-[4-(4-methylpiperazin-1-yl)sulfonylanilino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-12-one (PubChem CID 162360335) has the molecular formula C25H31N7O4S and a molecular weight of 525.64 g/mol. Its IUPAC name is 10-hydroxy-4-[4-(4-methylpiperazin-1-yl)sulfonylanilino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-12-one.
| Compound Name | 10-hydroxy-4-[4-(4-methylpiperazin-1-yl)sulfonylanilino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-12-one |
|---|---|
| PubChem CID | 162360335 |
| Molecular Formula | C25H31N7O4S |
| Molecular Weight | 525.64 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | 10-hydroxy-4-[4-(4-methylpiperazin-1-yl)sulfonylanilino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-12-one |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(Nc3ncc4cc5n(c4n3)C3(CCCCC3)C(=O)NC5O)cc2)CC1 |
| InChI | InChI=1S/C25H31N7O4S/c1-30-11-13-31(14-12-30)37(35,36)19-7-5-18(6-8-19)27-24-26-16-17-15-20-22(33)29-23(34)25(9-3-2-4-10-25)32(20)21(17)28-24/h5-8,15-16,22,33H,2-4,9-14H2,1H3,(H,29,34)(H,26,27,28) |
| InChIKey | CXMKIWPGGSLHRE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 132.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.64 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |