C19H19N6O3S- — CID 165172599
4-[(12-oxospiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl)amino]benzenesulfinate (PubChem CID 165172599) has the molecular formula C19H19N6O3S- and a molecular weight of 411.47 g/mol. Its IUPAC name is 4-[(12-oxospiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl)amino]benzenesulfinate.
| Compound Name | 4-[(12-oxospiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl)amino]benzenesulfinate |
|---|---|
| PubChem CID | 165172599 |
| Molecular Formula | C19H19N6O3S- |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 4-[(12-oxospiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl)amino]benzenesulfinate |
| SMILES | O=C1NNc2cc3cnc(Nc4ccc(S(=O)[O-])cc4)nc3n2C12CCCCC2 |
| InChI | InChI=1S/C19H20N6O3S/c26-17-19(8-2-1-3-9-19)25-15(23-24-17)10-12-11-20-18(22-16(12)25)21-13-4-6-14(7-5-13)29(27)28/h4-7,10-11,23H,1-3,8-9H2,(H,24,26)(H,27,28)(H,20,21,22)/p-1 |
| InChIKey | JUPDWAPJCSAORH-UHFFFAOYSA-M |
| XLogP | 2.53 |
| TPSA | 124.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|