C21H21F3N6O2S — CID 162360174
4-[[12-oxo-10-(trifluoromethyl)spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl]amino]benzenesulfinamide (PubChem CID 162360174) has the molecular formula C21H21F3N6O2S and a molecular weight of 478.50 g/mol. Its IUPAC name is 4-[[12-oxo-10-(trifluoromethyl)spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl]amino]benzenesulfinamide.
| Compound Name | 4-[[12-oxo-10-(trifluoromethyl)spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl]amino]benzenesulfinamide |
|---|---|
| PubChem CID | 162360174 |
| Molecular Formula | C21H21F3N6O2S |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 4-[[12-oxo-10-(trifluoromethyl)spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl]amino]benzenesulfinamide |
| SMILES | NS(=O)c1ccc(Nc2ncc3cc4n(c3n2)C2(CCCCC2)C(=O)NC4C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H21F3N6O2S/c22-21(23,24)16-15-10-12-11-26-19(27-13-4-6-14(7-5-13)33(25)32)29-17(12)30(15)20(18(31)28-16)8-2-1-3-9-20/h4-7,10-11,16H,1-3,8-9,25H2,(H,28,31)(H,26,27,29) |
| InChIKey | UXYWXPPATFJJCV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |