C20H22F2N6OS — CID 162360351
4-[[7-cyclohexyl-6-(2,2-difluoroethanimidoyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzenesulfinamide (PubChem CID 162360351) has the molecular formula C20H22F2N6OS and a molecular weight of 432.50 g/mol. Its IUPAC name is 4-[[7-cyclohexyl-6-(2,2-difluoroethanimidoyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzenesulfinamide.
| Compound Name | 4-[[7-cyclohexyl-6-(2,2-difluoroethanimidoyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzenesulfinamide |
|---|---|
| PubChem CID | 162360351 |
| Molecular Formula | C20H22F2N6OS |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 4-[[7-cyclohexyl-6-(2,2-difluoroethanimidoyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzenesulfinamide |
| SMILES | [H]/N=C(/c1cc2cnc(Nc3ccc(S(N)=O)cc3)nc2n1C1CCCCC1)C(F)F |
| InChI | InChI=1S/C20H22F2N6OS/c21-18(22)17(23)16-10-12-11-25-20(26-13-6-8-15(9-7-13)30(24)29)27-19(12)28(16)14-4-2-1-3-5-14/h6-11,14,18,23H,1-5,24H2,(H,25,26,27)/b23-17- |
| InChIKey | AJBOJMMCGLXOKR-QJOMJCCJSA-N |
| XLogP | 4.29 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|