C20H22F2KN6O2S- — CID 162360350
potassium;4-[[7-cyclohexyl-6-(2,2-difluoroethanimidoyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzenesulfinamide;hydroxide (PubChem CID 162360350) has the molecular formula C20H22F2KN6O2S- and a molecular weight of 487.60 g/mol. Its IUPAC name is potassium;4-[[7-cyclohexyl-6-(2,2-difluoroethanimidoyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzenesulfinamide;hydroxide.
| Compound Name | potassium;4-[[7-cyclohexyl-6-(2,2-difluoroethanimidoyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzenesulfinamide;hydroxide |
|---|---|
| PubChem CID | 162360350 |
| Molecular Formula | C20H22F2KN6O2S- |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | potassium;4-[[7-cyclohexyl-6-(2,2-difluoroethanimidoyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzenesulfinamide;hydroxide |
| SMILES | [H]/N=C(/c1cc2cnc(Nc3ccc(S(N)=O)cc3)nc2n1[C-]1CCCCC1)C(F)F.[K+].[OH-] |
| InChI | InChI=1S/C20H21F2N6OS.K.H2O/c21-18(22)17(23)16-10-12-11-25-20(26-13-6-8-15(9-7-13)30(24)29)27-19(12)28(16)14-4-2-1-3-5-14;;/h6-11,18,23H,1-5,24H2,(H,25,26,27);;1H2/q-1;+1;/p-1/b23-17-;; |
| InChIKey | NLLKWUGDPVOCAG-PKJXIURQSA-M |
| XLogP | 0.96 |
| TPSA | 139.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|