C17H13N5O2S — CID 143558628
4-[[7-(1,2-oxazol-4-yl)quinazolin-2-yl]amino]benzenesulfinamide (PubChem CID 143558628) has the molecular formula C17H13N5O2S and a molecular weight of 351.39 g/mol. Its IUPAC name is 4-[[7-(1,2-oxazol-4-yl)quinazolin-2-yl]amino]benzenesulfinamide.
| Compound Name | 4-[[7-(1,2-oxazol-4-yl)quinazolin-2-yl]amino]benzenesulfinamide |
|---|---|
| PubChem CID | 143558628 |
| Molecular Formula | C17H13N5O2S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 4-[[7-(1,2-oxazol-4-yl)quinazolin-2-yl]amino]benzenesulfinamide |
| SMILES | NS(=O)c1ccc(Nc2ncc3ccc(-c4cnoc4)cc3n2)cc1 |
| InChI | InChI=1S/C17H13N5O2S/c18-25(23)15-5-3-14(4-6-15)21-17-19-8-12-2-1-11(7-16(12)22-17)13-9-20-24-10-13/h1-10H,18H2,(H,19,21,22) |
| InChIKey | ZNPDVZGNAAEPMH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 106.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |