C20H16ClN5O3S — CID 67102551
4-[[7-(5-chloro-2-methoxy-4-pyridinyl)quinazolin-2-yl]amino]benzenesulfonamide (PubChem CID 67102551) has the molecular formula C20H16ClN5O3S and a molecular weight of 441.90 g/mol. Its IUPAC name is 4-[[7-(5-chloro-2-methoxy-4-pyridinyl)quinazolin-2-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[7-(5-chloro-2-methoxy-4-pyridinyl)quinazolin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 67102551 |
| Molecular Formula | C20H16ClN5O3S |
| Molecular Weight | 441.90 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 4-[[7-(5-chloro-2-methoxy-4-pyridinyl)quinazolin-2-yl]amino]benzenesulfonamide |
| SMILES | COc1cc(-c2ccc3cnc(Nc4ccc(S(N)(=O)=O)cc4)nc3c2)c(Cl)cn1 |
| InChI | InChI=1S/C20H16ClN5O3S/c1-29-19-9-16(17(21)11-23-19)12-2-3-13-10-24-20(26-18(13)8-12)25-14-4-6-15(7-5-14)30(22,27)28/h2-11H,1H3,(H2,22,27,28)(H,24,25,26) |
| InChIKey | AZGGBKIKEWOSER-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.90 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |